Product Information:
| Cat. No.: EX-A15040 | Purity: >98% |
![]() | |
| Chemical structure of IMP2 inhibitor 4 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1480482-51-6 |
|---|---|
| Purity | >98% |
| Formula | C21H14F3NO4 |
| Mol Weight | 401.3354 |
| Reference: | |
| CoA | CoA of IMP2 inhibitor 4 |
| Smiles: | O=C(O)C1=CC(OC(F)(F)F)=CC=C1NC(C2=CC=C(C3=CC=CC=C3)C=C2)=O |
|---|
KEYWORDS: buy IMP2 inhibitor 4 | IMP2 inhibitor 4 supplier | purchase | cost | manufacturer | order | distributor | buy 1480482-51-6 | 1480482-51-6 supplier


Inhibitor Specialist
